C15H16FN5O3 — CID 162440952
2-fluoro-N-[(3-methoxyfuran-2-yl)methyl]-9-(oxolan-2-yl)purin-6-amine (PubChem CID 162440952) has the molecular formula C15H16FN5O3 and a molecular weight of 333.32 g/mol. Its IUPAC name is 2-fluoro-N-[(3-methoxyfuran-2-yl)methyl]-9-(oxolan-2-yl)purin-6-amine.
| Compound Name | 2-fluoro-N-[(3-methoxyfuran-2-yl)methyl]-9-(oxolan-2-yl)purin-6-amine |
|---|---|
| PubChem CID | 162440952 |
| Molecular Formula | C15H16FN5O3 |
| Molecular Weight | 333.32 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | 2-fluoro-N-[(3-methoxyfuran-2-yl)methyl]-9-(oxolan-2-yl)purin-6-amine |
| SMILES | COc1ccoc1CNc1nc(F)nc2c1ncn2C1CCCO1 |
| InChI | InChI=1S/C15H16FN5O3/c1-22-9-4-6-23-10(9)7-17-13-12-14(20-15(16)19-13)21(8-18-12)11-3-2-5-24-11/h4,6,8,11H,2-3,5,7H2,1H3,(H,17,19,20) |
| InChIKey | IICHNZUYYJZZBE-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 87.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.32 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |