C20H22FN5O3 — CID 162440885
methyl 3-[[[2-fluoro-9-(oxepan-2-yl)purin-6-yl]amino]methyl]benzoate (PubChem CID 162440885) has the molecular formula C20H22FN5O3 and a molecular weight of 399.43 g/mol. Its IUPAC name is methyl 3-[[[2-fluoro-9-(oxepan-2-yl)purin-6-yl]amino]methyl]benzoate.
| Compound Name | methyl 3-[[[2-fluoro-9-(oxepan-2-yl)purin-6-yl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 162440885 |
| Molecular Formula | C20H22FN5O3 |
| Molecular Weight | 399.43 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | methyl 3-[[[2-fluoro-9-(oxepan-2-yl)purin-6-yl]amino]methyl]benzoate |
| SMILES | COC(=O)c1cccc(CNc2nc(F)nc3c2ncn3C2CCCCCO2)c1 |
| InChI | InChI=1S/C20H22FN5O3/c1-28-19(27)14-7-5-6-13(10-14)11-22-17-16-18(25-20(21)24-17)26(12-23-16)15-8-3-2-4-9-29-15/h5-7,10,12,15H,2-4,8-9,11H2,1H3,(H,22,24,25) |
| InChIKey | IMMCLKFGFKCHQX-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.43 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |