C17H17ClFN5O2 — CID 162441132
2-chloro-5-[[[2-fluoro-9-(oxan-2-yl)purin-6-yl]amino]methyl]phenol (PubChem CID 162441132) has the molecular formula C17H17ClFN5O2 and a molecular weight of 377.81 g/mol. Its IUPAC name is 2-chloro-5-[[[2-fluoro-9-(oxan-2-yl)purin-6-yl]amino]methyl]phenol.
| Compound Name | 2-chloro-5-[[[2-fluoro-9-(oxan-2-yl)purin-6-yl]amino]methyl]phenol |
|---|---|
| PubChem CID | 162441132 |
| Molecular Formula | C17H17ClFN5O2 |
| Molecular Weight | 377.81 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | 2-chloro-5-[[[2-fluoro-9-(oxan-2-yl)purin-6-yl]amino]methyl]phenol |
| SMILES | Oc1cc(CNc2nc(F)nc3c2ncn3C2CCCCO2)ccc1Cl |
| InChI | InChI=1S/C17H17ClFN5O2/c18-11-5-4-10(7-12(11)25)8-20-15-14-16(23-17(19)22-15)24(9-21-14)13-3-1-2-6-26-13/h4-5,7,9,13,25H,1-3,6,8H2,(H,20,22,23) |
| InChIKey | KSVDLSPIOZTVON-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.81 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |