C19H22FN5O3 — CID 162440956
5-[[[2-fluoro-9-(oxepan-2-yl)purin-6-yl]amino]methyl]-2-methoxyphenol (PubChem CID 162440956) has the molecular formula C19H22FN5O3 and a molecular weight of 387.42 g/mol. Its IUPAC name is 5-[[[2-fluoro-9-(oxepan-2-yl)purin-6-yl]amino]methyl]-2-methoxyphenol.
| Compound Name | 5-[[[2-fluoro-9-(oxepan-2-yl)purin-6-yl]amino]methyl]-2-methoxyphenol |
|---|---|
| PubChem CID | 162440956 |
| Molecular Formula | C19H22FN5O3 |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 5-[[[2-fluoro-9-(oxepan-2-yl)purin-6-yl]amino]methyl]-2-methoxyphenol |
| SMILES | COc1ccc(CNc2nc(F)nc3c2ncn3C2CCCCCO2)cc1O |
| InChI | InChI=1S/C19H22FN5O3/c1-27-14-7-6-12(9-13(14)26)10-21-17-16-18(24-19(20)23-17)25(11-22-16)15-5-3-2-4-8-28-15/h6-7,9,11,15,26H,2-5,8,10H2,1H3,(H,21,23,24) |
| InChIKey | XMRUNYATHMKMMC-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |