C16H16FN5O2 — CID 162441151
2-fluoro-N-[(3-methoxyphenyl)methyl]-9-(oxetan-2-yl)purin-6-amine (PubChem CID 162441151) has the molecular formula C16H16FN5O2 and a molecular weight of 329.34 g/mol. Its IUPAC name is 2-fluoro-N-[(3-methoxyphenyl)methyl]-9-(oxetan-2-yl)purin-6-amine.
| Compound Name | 2-fluoro-N-[(3-methoxyphenyl)methyl]-9-(oxetan-2-yl)purin-6-amine |
|---|---|
| PubChem CID | 162441151 |
| Molecular Formula | C16H16FN5O2 |
| Molecular Weight | 329.34 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | 2-fluoro-N-[(3-methoxyphenyl)methyl]-9-(oxetan-2-yl)purin-6-amine |
| SMILES | COc1cccc(CNc2nc(F)nc3c2ncn3C2CCO2)c1 |
| InChI | InChI=1S/C16H16FN5O2/c1-23-11-4-2-3-10(7-11)8-18-14-13-15(21-16(17)20-14)22(9-19-13)12-5-6-24-12/h2-4,7,9,12H,5-6,8H2,1H3,(H,18,20,21) |
| InChIKey | NNLCLRYVEWCPBJ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.34 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |