C24H37ClN10O — CID 145051987
N-[2-[4-[[[2-chloro-9-(oxan-2-yl)purin-6-yl]amino]methyl]triazol-1-yl]ethyl]-N'-cyclohexylpropane-1,3-diamine (PubChem CID 145051987) has the molecular formula C24H37ClN10O and a molecular weight of 517.08 g/mol. Its IUPAC name is N-[2-[4-[[[2-chloro-9-(oxan-2-yl)purin-6-yl]amino]methyl]triazol-1-yl]ethyl]-N'-cyclohexylpropane-1,3-diamine.
| Compound Name | N-[2-[4-[[[2-chloro-9-(oxan-2-yl)purin-6-yl]amino]methyl]triazol-1-yl]ethyl]-N'-cyclohexylpropane-1,3-diamine |
|---|---|
| PubChem CID | 145051987 |
| Molecular Formula | C24H37ClN10O |
| Molecular Weight | 517.08 g/mol |
| Exact Mass | 516.28 |
| IUPAC Name | N-[2-[4-[[[2-chloro-9-(oxan-2-yl)purin-6-yl]amino]methyl]triazol-1-yl]ethyl]-N'-cyclohexylpropane-1,3-diamine |
| SMILES | Clc1nc(NCc2cn(CCNCCCNC3CCCCC3)nn2)c2ncn(C3CCCCO3)c2n1 |
| InChI | InChI=1S/C24H37ClN10O/c25-24-30-22(21-23(31-24)35(17-29-21)20-9-4-5-14-36-20)28-15-19-16-34(33-32-19)13-12-26-10-6-11-27-18-7-2-1-3-8-18/h16-18,20,26-27H,1-15H2,(H,28,30,31) |
| InChIKey | RHPBMSMEQUQEAC-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 119.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.08 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|