C19H23ClN6O2 — CID 175836602
3-[[[2-chloro-9-(oxan-2-yl)purin-6-yl]amino]methyl]-4-ethyl-6-methyl-1H-pyridin-2-one (PubChem CID 175836602) has the molecular formula C19H23ClN6O2 and a molecular weight of 402.89 g/mol. Its IUPAC name is 3-[[[2-chloro-9-(oxan-2-yl)purin-6-yl]amino]methyl]-4-ethyl-6-methyl-1H-pyridin-2-one.
| Compound Name | 3-[[[2-chloro-9-(oxan-2-yl)purin-6-yl]amino]methyl]-4-ethyl-6-methyl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 175836602 |
| Molecular Formula | C19H23ClN6O2 |
| Molecular Weight | 402.89 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | 3-[[[2-chloro-9-(oxan-2-yl)purin-6-yl]amino]methyl]-4-ethyl-6-methyl-1H-pyridin-2-one |
| SMILES | CCc1cc(C)[nH]c(=O)c1CNc1nc(Cl)nc2c1ncn2C1CCCCO1 |
| InChI | InChI=1S/C19H23ClN6O2/c1-3-12-8-11(2)23-18(27)13(12)9-21-16-15-17(25-19(20)24-16)26(10-22-15)14-6-4-5-7-28-14/h8,10,14H,3-7,9H2,1-2H3,(H,23,27)(H,21,24,25) |
| InChIKey | JSHCGQBUDFBKEA-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 97.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.89 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |