C16H16ClN5O3 — CID 146574987
4-[[2-chloro-9-(oxan-2-yl)purin-6-yl]amino]benzene-1,3-diol (PubChem CID 146574987) has the molecular formula C16H16ClN5O3 and a molecular weight of 361.79 g/mol. Its IUPAC name is 4-[[2-chloro-9-(oxan-2-yl)purin-6-yl]amino]benzene-1,3-diol.
| Compound Name | 4-[[2-chloro-9-(oxan-2-yl)purin-6-yl]amino]benzene-1,3-diol |
|---|---|
| PubChem CID | 146574987 |
| Molecular Formula | C16H16ClN5O3 |
| Molecular Weight | 361.79 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | 4-[[2-chloro-9-(oxan-2-yl)purin-6-yl]amino]benzene-1,3-diol |
| SMILES | Oc1ccc(Nc2nc(Cl)nc3c2ncn3C2CCCCO2)c(O)c1 |
| InChI | InChI=1S/C16H16ClN5O3/c17-16-20-14(19-10-5-4-9(23)7-11(10)24)13-15(21-16)22(8-18-13)12-3-1-2-6-25-12/h4-5,7-8,12,23-24H,1-3,6H2,(H,19,20,21) |
| InChIKey | PIGXOVYGJYWBMQ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.79 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|