C15H15ClN6O — CID 146575151
3-N-[2-chloro-9-(oxolan-2-yl)purin-6-yl]benzene-1,3-diamine (PubChem CID 146575151) has the molecular formula C15H15ClN6O and a molecular weight of 330.78 g/mol. Its IUPAC name is 3-N-[2-chloro-9-(oxolan-2-yl)purin-6-yl]benzene-1,3-diamine.
| Compound Name | 3-N-[2-chloro-9-(oxolan-2-yl)purin-6-yl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 146575151 |
| Molecular Formula | C15H15ClN6O |
| Molecular Weight | 330.78 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 3-N-[2-chloro-9-(oxolan-2-yl)purin-6-yl]benzene-1,3-diamine |
| SMILES | Nc1cccc(Nc2nc(Cl)nc3c2ncn3C2CCCO2)c1 |
| InChI | InChI=1S/C15H15ClN6O/c16-15-20-13(19-10-4-1-3-9(17)7-10)12-14(21-15)22(8-18-12)11-5-2-6-23-11/h1,3-4,7-8,11H,2,5-6,17H2,(H,19,20,21) |
| InChIKey | AQRNTTKBKKXPBW-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.78 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|