C16H17FN6O — CID 146574821
4-N-[2-fluoro-9-(oxan-2-yl)purin-6-yl]benzene-1,4-diamine (PubChem CID 146574821) has the molecular formula C16H17FN6O and a molecular weight of 328.35 g/mol. Its IUPAC name is 4-N-[2-fluoro-9-(oxan-2-yl)purin-6-yl]benzene-1,4-diamine.
| Compound Name | 4-N-[2-fluoro-9-(oxan-2-yl)purin-6-yl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 146574821 |
| Molecular Formula | C16H17FN6O |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 4-N-[2-fluoro-9-(oxan-2-yl)purin-6-yl]benzene-1,4-diamine |
| SMILES | Nc1ccc(Nc2nc(F)nc3c2ncn3C2CCCCO2)cc1 |
| InChI | InChI=1S/C16H17FN6O/c17-16-21-14(20-11-6-4-10(18)5-7-11)13-15(22-16)23(9-19-13)12-3-1-2-8-24-12/h4-7,9,12H,1-3,8,18H2,(H,20,21,22) |
| InChIKey | MSXFWXPXLSHNDQ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|