C17H18ClN5OS — CID 146574646
N-(4-chlorophenyl)-2-methylsulfanyl-9-(oxan-2-yl)purin-6-amine (PubChem CID 146574646) has the molecular formula C17H18ClN5OS and a molecular weight of 375.89 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-methylsulfanyl-9-(oxan-2-yl)purin-6-amine.
| Compound Name | N-(4-chlorophenyl)-2-methylsulfanyl-9-(oxan-2-yl)purin-6-amine |
|---|---|
| PubChem CID | 146574646 |
| Molecular Formula | C17H18ClN5OS |
| Molecular Weight | 375.89 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | N-(4-chlorophenyl)-2-methylsulfanyl-9-(oxan-2-yl)purin-6-amine |
| SMILES | CSc1nc(Nc2ccc(Cl)cc2)c2ncn(C3CCCCO3)c2n1 |
| InChI | InChI=1S/C17H18ClN5OS/c1-25-17-21-15(20-12-7-5-11(18)6-8-12)14-16(22-17)23(10-19-14)13-4-2-3-9-24-13/h5-8,10,13H,2-4,9H2,1H3,(H,20,21,22) |
| InChIKey | KKCLYVRUGKBTRH-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.89 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |