C19H23N5O2S — CID 146574792
N-(4-ethoxyphenyl)-2-methylsulfanyl-9-(oxan-2-yl)purin-6-amine (PubChem CID 146574792) has the molecular formula C19H23N5O2S and a molecular weight of 385.49 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-2-methylsulfanyl-9-(oxan-2-yl)purin-6-amine.
| Compound Name | N-(4-ethoxyphenyl)-2-methylsulfanyl-9-(oxan-2-yl)purin-6-amine |
|---|---|
| PubChem CID | 146574792 |
| Molecular Formula | C19H23N5O2S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | N-(4-ethoxyphenyl)-2-methylsulfanyl-9-(oxan-2-yl)purin-6-amine |
| SMILES | CCOc1ccc(Nc2nc(SC)nc3c2ncn3C2CCCCO2)cc1 |
| InChI | InChI=1S/C19H23N5O2S/c1-3-25-14-9-7-13(8-10-14)21-17-16-18(23-19(22-17)27-2)24(12-20-16)15-6-4-5-11-26-15/h7-10,12,15H,3-6,11H2,1-2H3,(H,21,22,23) |
| InChIKey | DSPAVVWRESPSRZ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |