C28H38N6O4 — CID 142735246
methyl 5-[4-[[6-(cyclohexylamino)-9-(oxan-2-yl)purin-2-yl]amino]phenoxy]pentanoate (PubChem CID 142735246) has the molecular formula C28H38N6O4 and a molecular weight of 522.65 g/mol. Its IUPAC name is methyl 5-[4-[[6-(cyclohexylamino)-9-(oxan-2-yl)purin-2-yl]amino]phenoxy]pentanoate.
| Compound Name | methyl 5-[4-[[6-(cyclohexylamino)-9-(oxan-2-yl)purin-2-yl]amino]phenoxy]pentanoate |
|---|---|
| PubChem CID | 142735246 |
| Molecular Formula | C28H38N6O4 |
| Molecular Weight | 522.65 g/mol |
| Exact Mass | 522.30 |
| IUPAC Name | methyl 5-[4-[[6-(cyclohexylamino)-9-(oxan-2-yl)purin-2-yl]amino]phenoxy]pentanoate |
| SMILES | COC(=O)CCCCOc1ccc(Nc2nc(NC3CCCCC3)c3ncn(C4CCCCO4)c3n2)cc1 |
| InChI | InChI=1S/C28H38N6O4/c1-36-24(35)12-6-8-17-37-22-15-13-21(14-16-22)31-28-32-26(30-20-9-3-2-4-10-20)25-27(33-28)34(19-29-25)23-11-5-7-18-38-23/h13-16,19-20,23H,2-12,17-18H2,1H3,(H2,30,31,32,33) |
| InChIKey | ZVLHDHJHVPCNTL-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 112.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.65 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|