C34H49N7O5 — CID 118515604
7-[4-[[6-(cyclohexylamino)-9-(oxan-2-yl)purin-2-yl]amino]phenoxy]-N-(oxan-2-yloxy)heptanamide (PubChem CID 118515604) has the molecular formula C34H49N7O5 and a molecular weight of 635.81 g/mol. Its IUPAC name is 7-[4-[[6-(cyclohexylamino)-9-(oxan-2-yl)purin-2-yl]amino]phenoxy]-N-(oxan-2-yloxy)heptanamide.
| Compound Name | 7-[4-[[6-(cyclohexylamino)-9-(oxan-2-yl)purin-2-yl]amino]phenoxy]-N-(oxan-2-yloxy)heptanamide |
|---|---|
| PubChem CID | 118515604 |
| Molecular Formula | C34H49N7O5 |
| Molecular Weight | 635.81 g/mol |
| Exact Mass | 635.38 |
| IUPAC Name | 7-[4-[[6-(cyclohexylamino)-9-(oxan-2-yl)purin-2-yl]amino]phenoxy]-N-(oxan-2-yloxy)heptanamide |
| SMILES | O=C(CCCCCCOc1ccc(Nc2nc(NC3CCCCC3)c3ncn(C4CCCCO4)c3n2)cc1)NOC1CCCCO1 |
| InChI | InChI=1S/C34H49N7O5/c42-28(40-46-30-16-8-11-23-45-30)14-6-1-2-9-21-43-27-19-17-26(18-20-27)37-34-38-32(36-25-12-4-3-5-13-25)31-33(39-34)41(24-35-31)29-15-7-10-22-44-29/h17-20,24-25,29-30H,1-16,21-23H2,(H,40,42)(H2,36,37,38,39) |
| InChIKey | OLEKEVNBFUJLFL-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 133.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.81 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|