C25H34N6O3 — CID 159019262
8-[4-[[6-(cyclohexylamino)-7H-purin-2-yl]amino]phenoxy]-1-hydroxyoctan-2-one (PubChem CID 159019262) has the molecular formula C25H34N6O3 and a molecular weight of 466.59 g/mol. Its IUPAC name is 8-[4-[[6-(cyclohexylamino)-7H-purin-2-yl]amino]phenoxy]-1-hydroxyoctan-2-one.
| Compound Name | 8-[4-[[6-(cyclohexylamino)-7H-purin-2-yl]amino]phenoxy]-1-hydroxyoctan-2-one |
|---|---|
| PubChem CID | 159019262 |
| Molecular Formula | C25H34N6O3 |
| Molecular Weight | 466.59 g/mol |
| Exact Mass | 466.27 |
| IUPAC Name | 8-[4-[[6-(cyclohexylamino)-7H-purin-2-yl]amino]phenoxy]-1-hydroxyoctan-2-one |
| SMILES | O=C(CO)CCCCCCOc1ccc(Nc2nc(NC3CCCCC3)c3[nH]cnc3n2)cc1 |
| InChI | InChI=1S/C25H34N6O3/c32-16-20(33)10-6-1-2-7-15-34-21-13-11-19(12-14-21)29-25-30-23-22(26-17-27-23)24(31-25)28-18-8-4-3-5-9-18/h11-14,17-18,32H,1-10,15-16H2,(H3,26,27,28,29,30,31) |
| InChIKey | SXVVEZGBPUVKPQ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 125.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.59 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|