C25H31N9O2 — CID 46926982
N-[3-[4-[[6-(cyclohexylamino)-7H-purin-2-yl]amino]-3-methylphenoxy]propyl]-1H-imidazole-2-carboxamide (PubChem CID 46926982) has the molecular formula C25H31N9O2 and a molecular weight of 489.58 g/mol. Its IUPAC name is N-[3-[4-[[6-(cyclohexylamino)-7H-purin-2-yl]amino]-3-methylphenoxy]propyl]-1H-imidazole-2-carboxamide.
| Compound Name | N-[3-[4-[[6-(cyclohexylamino)-7H-purin-2-yl]amino]-3-methylphenoxy]propyl]-1H-imidazole-2-carboxamide |
|---|---|
| PubChem CID | 46926982 |
| Molecular Formula | C25H31N9O2 |
| Molecular Weight | 489.58 g/mol |
| Exact Mass | 489.26 |
| IUPAC Name | N-[3-[4-[[6-(cyclohexylamino)-7H-purin-2-yl]amino]-3-methylphenoxy]propyl]-1H-imidazole-2-carboxamide |
| SMILES | Cc1cc(OCCCNC(=O)c2ncc[nH]2)ccc1Nc1nc(NC2CCCCC2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C25H31N9O2/c1-16-14-18(36-13-5-10-28-24(35)23-26-11-12-27-23)8-9-19(16)32-25-33-21-20(29-15-30-21)22(34-25)31-17-6-3-2-4-7-17/h8-9,11-12,14-15,17H,2-7,10,13H2,1H3,(H,26,27)(H,28,35)(H3,29,30,31,32,33,34) |
| InChIKey | KGCXBQGVCGGSDD-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 145.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.58 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|