C19H24N6O — CID 91243419
6-N-cyclohexyl-2-N-(2-methoxy-4-methylphenyl)-7H-purine-2,6-diamine (PubChem CID 91243419) has the molecular formula C19H24N6O and a molecular weight of 352.44 g/mol. Its IUPAC name is 6-N-cyclohexyl-2-N-(2-methoxy-4-methylphenyl)-7H-purine-2,6-diamine.
| Compound Name | 6-N-cyclohexyl-2-N-(2-methoxy-4-methylphenyl)-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 91243419 |
| Molecular Formula | C19H24N6O |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | 6-N-cyclohexyl-2-N-(2-methoxy-4-methylphenyl)-7H-purine-2,6-diamine |
| SMILES | COc1cc(C)ccc1Nc1nc(NC2CCCCC2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C19H24N6O/c1-12-8-9-14(15(10-12)26-2)23-19-24-17-16(20-11-21-17)18(25-19)22-13-6-4-3-5-7-13/h8-11,13H,3-7H2,1-2H3,(H3,20,21,22,23,24,25) |
| InChIKey | DDKCPJJWAZOKSQ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 87.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |