C24H29N7O3 — CID 69180929
2-N-[2-methoxy-4-(3-morpholin-4-ylprop-1-ynyl)phenyl]-6-N-(oxan-4-yl)-7H-purine-2,6-diamine (PubChem CID 69180929) has the molecular formula C24H29N7O3 and a molecular weight of 463.54 g/mol. Its IUPAC name is 2-N-[2-methoxy-4-(3-morpholin-4-ylprop-1-ynyl)phenyl]-6-N-(oxan-4-yl)-7H-purine-2,6-diamine.
| Compound Name | 2-N-[2-methoxy-4-(3-morpholin-4-ylprop-1-ynyl)phenyl]-6-N-(oxan-4-yl)-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 69180929 |
| Molecular Formula | C24H29N7O3 |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.23 |
| IUPAC Name | 2-N-[2-methoxy-4-(3-morpholin-4-ylprop-1-ynyl)phenyl]-6-N-(oxan-4-yl)-7H-purine-2,6-diamine |
| SMILES | COc1cc(C#CCN2CCOCC2)ccc1Nc1nc(NC2CCOCC2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C24H29N7O3/c1-32-20-15-17(3-2-8-31-9-13-34-14-10-31)4-5-19(20)28-24-29-22-21(25-16-26-22)23(30-24)27-18-6-11-33-12-7-18/h4-5,15-16,18H,6-14H2,1H3,(H3,25,26,27,28,29,30) |
| InChIKey | BWBRQZLWVQSVGH-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 109.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|