C19H23N7OS2 — CID 146282299
6-N-[(4S)-dithian-4-yl]-2-N-(4-morpholin-4-ylphenyl)-7H-purine-2,6-diamine (PubChem CID 146282299) has the molecular formula C19H23N7OS2 and a molecular weight of 429.58 g/mol. Its IUPAC name is 6-N-[(4S)-dithian-4-yl]-2-N-(4-morpholin-4-ylphenyl)-7H-purine-2,6-diamine.
| Compound Name | 6-N-[(4S)-dithian-4-yl]-2-N-(4-morpholin-4-ylphenyl)-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 146282299 |
| Molecular Formula | C19H23N7OS2 |
| Molecular Weight | 429.58 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | 6-N-[(4S)-dithian-4-yl]-2-N-(4-morpholin-4-ylphenyl)-7H-purine-2,6-diamine |
| SMILES | c1nc2nc(Nc3ccc(N4CCOCC4)cc3)nc(N[C@H]3CCSSC3)c2[nH]1 |
| InChI | InChI=1S/C19H23N7OS2/c1-3-15(26-6-8-27-9-7-26)4-2-13(1)23-19-24-17-16(20-12-21-17)18(25-19)22-14-5-10-28-29-11-14/h1-4,12,14H,5-11H2,(H3,20,21,22,23,24,25)/t14-/m0/s1 |
| InChIKey | SEXAICRHSPFXAW-AWEZNQCLSA-N |
| XLogP | 3.50 |
| TPSA | 90.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.58 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|