C21H29N7O — CID 143049590
4-N-cyclopentyl-2-N-(4-morpholin-4-ylphenyl)-5,6,7,8-tetrahydropteridine-2,4-diamine (PubChem CID 143049590) has the molecular formula C21H29N7O and a molecular weight of 395.51 g/mol. Its IUPAC name is 4-N-cyclopentyl-2-N-(4-morpholin-4-ylphenyl)-5,6,7,8-tetrahydropteridine-2,4-diamine.
| Compound Name | 4-N-cyclopentyl-2-N-(4-morpholin-4-ylphenyl)-5,6,7,8-tetrahydropteridine-2,4-diamine |
|---|---|
| PubChem CID | 143049590 |
| Molecular Formula | C21H29N7O |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.24 |
| IUPAC Name | 4-N-cyclopentyl-2-N-(4-morpholin-4-ylphenyl)-5,6,7,8-tetrahydropteridine-2,4-diamine |
| SMILES | c1cc(N2CCOCC2)ccc1Nc1nc2c(c(NC3CCCC3)n1)NCCN2 |
| InChI | InChI=1S/C21H29N7O/c1-2-4-15(3-1)24-20-18-19(23-10-9-22-18)26-21(27-20)25-16-5-7-17(8-6-16)28-11-13-29-14-12-28/h5-8,15,22H,1-4,9-14H2,(H3,23,24,25,26,27) |
| InChIKey | NOQZUXZJIGNYDC-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 86.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|