C20H25N7Se2 — CID 158553885
6-N-cyclopentyl-2-N-[4-(1,2,5-diselenazepan-5-yl)phenyl]-7H-purine-2,6-diamine (PubChem CID 158553885) has the molecular formula C20H25N7Se2 and a molecular weight of 521.39 g/mol. Its IUPAC name is 6-N-cyclopentyl-2-N-[4-(1,2,5-diselenazepan-5-yl)phenyl]-7H-purine-2,6-diamine.
| Compound Name | 6-N-cyclopentyl-2-N-[4-(1,2,5-diselenazepan-5-yl)phenyl]-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 158553885 |
| Molecular Formula | C20H25N7Se2 |
| Molecular Weight | 521.39 g/mol |
| Exact Mass | 523.05 |
| IUPAC Name | 6-N-cyclopentyl-2-N-[4-(1,2,5-diselenazepan-5-yl)phenyl]-7H-purine-2,6-diamine |
| SMILES | c1nc2nc(Nc3ccc(N4CC[Se][Se]CC4)cc3)nc(NC3CCCC3)c2[nH]1 |
| InChI | InChI=1S/C20H25N7Se2/c1-2-4-14(3-1)23-19-17-18(22-13-21-17)25-20(26-19)24-15-5-7-16(8-6-15)27-9-11-28-29-12-10-27/h5-8,13-14H,1-4,9-12H2,(H3,21,22,23,24,25,26) |
| InChIKey | AVZQFTOIRGCJKC-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 81.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.39 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|