C19H23N7Se3 — CID 158553883
2-N-[4-(1,2,5-diselenazepan-5-yl)phenyl]-6-N-(selenolan-3-yl)-7H-purine-2,6-diamine (PubChem CID 158553883) has the molecular formula C19H23N7Se3 and a molecular weight of 586.32 g/mol. Its IUPAC name is 2-N-[4-(1,2,5-diselenazepan-5-yl)phenyl]-6-N-(selenolan-3-yl)-7H-purine-2,6-diamine.
| Compound Name | 2-N-[4-(1,2,5-diselenazepan-5-yl)phenyl]-6-N-(selenolan-3-yl)-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 158553883 |
| Molecular Formula | C19H23N7Se3 |
| Molecular Weight | 586.32 g/mol |
| Exact Mass | 588.95 |
| IUPAC Name | 2-N-[4-(1,2,5-diselenazepan-5-yl)phenyl]-6-N-(selenolan-3-yl)-7H-purine-2,6-diamine |
| SMILES | c1nc2nc(Nc3ccc(N4CC[Se][Se]CC4)cc3)nc(NC3CC[Se]C3)c2[nH]1 |
| InChI | InChI=1S/C19H23N7Se3/c1-3-15(26-6-9-28-29-10-7-26)4-2-13(1)23-19-24-17-16(20-12-21-17)18(25-19)22-14-5-8-27-11-14/h1-4,12,14H,5-11H2,(H3,20,21,22,23,24,25) |
| InChIKey | WFCSCKTZHVDADN-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 81.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.32 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|