C22H28N8O — CID 174686616
1-[4-[4-[(6-piperidin-1-yl-7H-purin-2-yl)amino]phenyl]piperazin-1-yl]ethanone (PubChem CID 174686616) has the molecular formula C22H28N8O and a molecular weight of 420.52 g/mol. Its IUPAC name is 1-[4-[4-[(6-piperidin-1-yl-7H-purin-2-yl)amino]phenyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[4-[(6-piperidin-1-yl-7H-purin-2-yl)amino]phenyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 174686616 |
| Molecular Formula | C22H28N8O |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | 1-[4-[4-[(6-piperidin-1-yl-7H-purin-2-yl)amino]phenyl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(c2ccc(Nc3nc(N4CCCCC4)c4[nH]cnc4n3)cc2)CC1 |
| InChI | InChI=1S/C22H28N8O/c1-16(31)28-11-13-29(14-12-28)18-7-5-17(6-8-18)25-22-26-20-19(23-15-24-20)21(27-22)30-9-3-2-4-10-30/h5-8,15H,2-4,9-14H2,1H3,(H2,23,24,25,26,27) |
| InChIKey | LNPIEDKPKGMHHV-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 93.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|