C21H26N8O2 — CID 71244213
(3R)-1-[2-(4-piperazin-1-ylanilino)-7H-purin-6-yl]piperidine-3-carboxylic acid (PubChem CID 71244213) has the molecular formula C21H26N8O2 and a molecular weight of 422.49 g/mol. Its IUPAC name is (3R)-1-[2-(4-piperazin-1-ylanilino)-7H-purin-6-yl]piperidine-3-carboxylic acid.
| Compound Name | (3R)-1-[2-(4-piperazin-1-ylanilino)-7H-purin-6-yl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 71244213 |
| Molecular Formula | C21H26N8O2 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | (3R)-1-[2-(4-piperazin-1-ylanilino)-7H-purin-6-yl]piperidine-3-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCCN(c2nc(Nc3ccc(N4CCNCC4)cc3)nc3nc[nH]c23)C1 |
| InChI | InChI=1S/C21H26N8O2/c30-20(31)14-2-1-9-29(12-14)19-17-18(24-13-23-17)26-21(27-19)25-15-3-5-16(6-4-15)28-10-7-22-8-11-28/h3-6,13-14,22H,1-2,7-12H2,(H,30,31)(H2,23,24,25,26,27)/t14-/m1/s1 |
| InChIKey | XZGJAHQTUQUDGB-CQSZACIVSA-N |
| XLogP | 1.81 |
| TPSA | 122.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|