C14H21N7 — CID 114785647
6-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-N-methyl-7H-purin-2-amine (PubChem CID 114785647) has the molecular formula C14H21N7 and a molecular weight of 287.37 g/mol. Its IUPAC name is 6-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-N-methyl-7H-purin-2-amine.
| Compound Name | 6-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-N-methyl-7H-purin-2-amine |
|---|---|
| PubChem CID | 114785647 |
| Molecular Formula | C14H21N7 |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | 6-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-N-methyl-7H-purin-2-amine |
| SMILES | CNc1nc(N2CCN3CCCCC3C2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C14H21N7/c1-15-14-18-12-11(16-9-17-12)13(19-14)21-7-6-20-5-3-2-4-10(20)8-21/h9-10H,2-8H2,1H3,(H2,15,16,17,18,19) |
| InChIKey | LGZXKOZYUMJUBY-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 72.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |