C14H20N6 — CID 114785462
6-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)-N-methyl-7H-purin-2-amine (PubChem CID 114785462) has the molecular formula C14H20N6 and a molecular weight of 272.36 g/mol. Its IUPAC name is 6-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)-N-methyl-7H-purin-2-amine.
| Compound Name | 6-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)-N-methyl-7H-purin-2-amine |
|---|---|
| PubChem CID | 114785462 |
| Molecular Formula | C14H20N6 |
| Molecular Weight | 272.36 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | 6-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)-N-methyl-7H-purin-2-amine |
| SMILES | CNc1nc(N2CCCC3CCCC32)c2[nH]cnc2n1 |
| InChI | InChI=1S/C14H20N6/c1-15-14-18-12-11(16-8-17-12)13(19-14)20-7-3-5-9-4-2-6-10(9)20/h8-10H,2-7H2,1H3,(H2,15,16,17,18,19) |
| InChIKey | QZRNIGGTXMGVLF-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.36 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |