C10H14N6O2S — CID 114783973
6-(1,1-dioxo-1,4-thiazinan-4-yl)-N-methyl-7H-purin-2-amine (PubChem CID 114783973) has the molecular formula C10H14N6O2S and a molecular weight of 282.33 g/mol. Its IUPAC name is 6-(1,1-dioxo-1,4-thiazinan-4-yl)-N-methyl-7H-purin-2-amine.
| Compound Name | 6-(1,1-dioxo-1,4-thiazinan-4-yl)-N-methyl-7H-purin-2-amine |
|---|---|
| PubChem CID | 114783973 |
| Molecular Formula | C10H14N6O2S |
| Molecular Weight | 282.33 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 6-(1,1-dioxo-1,4-thiazinan-4-yl)-N-methyl-7H-purin-2-amine |
| SMILES | CNc1nc(N2CCS(=O)(=O)CC2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C10H14N6O2S/c1-11-10-14-8-7(12-6-13-8)9(15-10)16-2-4-19(17,18)5-3-16/h6H,2-5H2,1H3,(H2,11,12,13,14,15) |
| InChIKey | FSMZRGHTNZSIRT-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.33 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |