C12H17N7O — CID 114785109
1-[2-(ethylamino)-7H-purin-6-yl]-1,4-diazepan-5-one (PubChem CID 114785109) has the molecular formula C12H17N7O and a molecular weight of 275.32 g/mol. Its IUPAC name is 1-[2-(ethylamino)-7H-purin-6-yl]-1,4-diazepan-5-one.
| Compound Name | 1-[2-(ethylamino)-7H-purin-6-yl]-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 114785109 |
| Molecular Formula | C12H17N7O |
| Molecular Weight | 275.32 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 1-[2-(ethylamino)-7H-purin-6-yl]-1,4-diazepan-5-one |
| SMILES | CCNc1nc(N2CCNC(=O)CC2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C12H17N7O/c1-2-13-12-17-10-9(15-7-16-10)11(18-12)19-5-3-8(20)14-4-6-19/h7H,2-6H2,1H3,(H,14,20)(H2,13,15,16,17,18) |
| InChIKey | ZNUJXHCXKGVXHL-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.32 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |