C13H18N8 — CID 114786743
6-(3,5-diethyl-1,2,4-triazol-1-yl)-N-ethyl-7H-purin-2-amine (PubChem CID 114786743) has the molecular formula C13H18N8 and a molecular weight of 286.34 g/mol. Its IUPAC name is 6-(3,5-diethyl-1,2,4-triazol-1-yl)-N-ethyl-7H-purin-2-amine.
| Compound Name | 6-(3,5-diethyl-1,2,4-triazol-1-yl)-N-ethyl-7H-purin-2-amine |
|---|---|
| PubChem CID | 114786743 |
| Molecular Formula | C13H18N8 |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 6-(3,5-diethyl-1,2,4-triazol-1-yl)-N-ethyl-7H-purin-2-amine |
| SMILES | CCNc1nc(-n2nc(CC)nc2CC)c2[nH]cnc2n1 |
| InChI | InChI=1S/C13H18N8/c1-4-8-17-9(5-2)21(20-8)12-10-11(16-7-15-10)18-13(19-12)14-6-3/h7H,4-6H2,1-3H3,(H2,14,15,16,18,19) |
| InChIKey | ASVLGIHTLYGZTE-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 97.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |