C11H12ClN7 — CID 104787488
2-chloro-6-(3,5-diethyl-1,2,4-triazol-1-yl)-7H-purine (PubChem CID 104787488) has the molecular formula C11H12ClN7 and a molecular weight of 277.72 g/mol. Its IUPAC name is 2-chloro-6-(3,5-diethyl-1,2,4-triazol-1-yl)-7H-purine.
| Compound Name | 2-chloro-6-(3,5-diethyl-1,2,4-triazol-1-yl)-7H-purine |
|---|---|
| PubChem CID | 104787488 |
| Molecular Formula | C11H12ClN7 |
| Molecular Weight | 277.72 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | 2-chloro-6-(3,5-diethyl-1,2,4-triazol-1-yl)-7H-purine |
| SMILES | CCc1nc(CC)n(-c2nc(Cl)nc3nc[nH]c23)n1 |
| InChI | InChI=1S/C11H12ClN7/c1-3-6-15-7(4-2)19(18-6)10-8-9(14-5-13-8)16-11(12)17-10/h5H,3-4H2,1-2H3,(H,13,14,16,17) |
| InChIKey | OLJJWEDKJGBDAY-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.72 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |