C10H14ClN7 — CID 80904057
[5-chloro-4-(3,5-diethyl-1,2,4-triazol-1-yl)pyrimidin-2-yl]hydrazine (PubChem CID 80904057) has the molecular formula C10H14ClN7 and a molecular weight of 267.72 g/mol. Its IUPAC name is [5-chloro-4-(3,5-diethyl-1,2,4-triazol-1-yl)pyrimidin-2-yl]hydrazine.
| Compound Name | [5-chloro-4-(3,5-diethyl-1,2,4-triazol-1-yl)pyrimidin-2-yl]hydrazine |
|---|---|
| PubChem CID | 80904057 |
| Molecular Formula | C10H14ClN7 |
| Molecular Weight | 267.72 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | [5-chloro-4-(3,5-diethyl-1,2,4-triazol-1-yl)pyrimidin-2-yl]hydrazine |
| SMILES | CCc1nc(CC)n(-c2nc(NN)ncc2Cl)n1 |
| InChI | InChI=1S/C10H14ClN7/c1-3-7-14-8(4-2)18(17-7)9-6(11)5-13-10(15-9)16-12/h5H,3-4,12H2,1-2H3,(H,13,15,16) |
| InChIKey | NRDPADDAUTYUPY-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.72 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|