About 1-(5-chloro-2-hydrazinylpyrimidin-4-yl)pyrrolidine-3,4-diol
1-(5-chloro-2-hydrazinylpyrimidin-4-yl)pyrrolidine-3,4-diol (PubChem CID 106674652) has the molecular formula C8H12ClN5O2
and a molecular weight of 245.67 g/mol. Its IUPAC name is 1-(5-chloro-2-hydrazinylpyrimidin-4-yl)pyrrolidine-3,4-diol.
Molecular Properties
| Compound Name | 1-(5-chloro-2-hydrazinylpyrimidin-4-yl)pyrrolidine-3,4-diol |
| PubChem CID | 106674652 |
| Molecular Formula | C8H12ClN5O2 |
| Molecular Weight | 245.67 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 1-(5-chloro-2-hydrazinylpyrimidin-4-yl)pyrrolidine-3,4-diol |
| SMILES | NNc1ncc(Cl)c(N2CC(O)C(O)C2)n1 |
| InChI | InChI=1S/C8H12ClN5O2/c9-4-1-11-8(13-10)12-7(4)14-2-5(15)6(16)3-14/h1,5-6,15-16H,2-3,10H2,(H,11,12,13) |
| InChIKey | HZLUYTMIVFYWAX-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.67 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(5-chloro-2-hydrazinylpyrimidin-4-yl)pyrrolidine-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-chloro-2-hydrazinylpyrimidin-4-yl)pyrrolidine-3,4-diol?
The IUPAC name of 1-(5-chloro-2-hydrazinylpyrimidin-4-yl)pyrrolidine-3,4-diol (CID 106674652) is 1-(5-chloro-2-hydrazinylpyrimidin-4-yl)pyrrolidine-3,4-diol.
What is the SMILES notation for 1-(5-chloro-2-hydrazinylpyrimidin-4-yl)pyrrolidine-3,4-diol?
The canonical SMILES for 1-(5-chloro-2-hydrazinylpyrimidin-4-yl)pyrrolidine-3,4-diol is NNc1ncc(Cl)c(N2CC(O)C(O)C2)n1.
What is the InChIKey of 1-(5-chloro-2-hydrazinylpyrimidin-4-yl)pyrrolidine-3,4-diol?
The InChIKey is HZLUYTMIVFYWAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12ClN5O2/c9-4-1-11-8(13-10)12-7(4)14-2-5(15)6(16)3-14/h1,5-6,15-16H,2-3,10H2,(H,11,12,13).
What are the key properties of 1-(5-chloro-2-hydrazinylpyrimidin-4-yl)pyrrolidine-3,4-diol?
1-(5-chloro-2-hydrazinylpyrimidin-4-yl)pyrrolidine-3,4-diol has a molecular weight of 245.67 g/mol, XLogP of -1.04, 2 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-chloro-2-hydrazinylpyrimidin-4-yl)pyrrolidine-3,4-diol is sourced from PubChem (CID 106674652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).