C8H12ClN5O2 — CID 106674652
1-(5-chloro-2-hydrazinylpyrimidin-4-yl)pyrrolidine-3,4-diol (PubChem CID 106674652) has the molecular formula C8H12ClN5O2 and a molecular weight of 245.67 g/mol. Its IUPAC name is 1-(5-chloro-2-hydrazinylpyrimidin-4-yl)pyrrolidine-3,4-diol.
| Compound Name | 1-(5-chloro-2-hydrazinylpyrimidin-4-yl)pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 106674652 |
| Molecular Formula | C8H12ClN5O2 |
| Molecular Weight | 245.67 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 1-(5-chloro-2-hydrazinylpyrimidin-4-yl)pyrrolidine-3,4-diol |
| SMILES | NNc1ncc(Cl)c(N2CC(O)C(O)C2)n1 |
| InChI | InChI=1S/C8H12ClN5O2/c9-4-1-11-8(13-10)12-7(4)14-2-5(15)6(16)3-14/h1,5-6,15-16H,2-3,10H2,(H,11,12,13) |
| InChIKey | HZLUYTMIVFYWAX-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.67 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|