C10H17ClN6 — CID 80914551
1-(5-chloro-2-hydrazinylpyrimidin-4-yl)-N,N-dimethylpyrrolidin-3-amine (PubChem CID 80914551) has the molecular formula C10H17ClN6 and a molecular weight of 256.74 g/mol. Its IUPAC name is 1-(5-chloro-2-hydrazinylpyrimidin-4-yl)-N,N-dimethylpyrrolidin-3-amine.
| Compound Name | 1-(5-chloro-2-hydrazinylpyrimidin-4-yl)-N,N-dimethylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 80914551 |
| Molecular Formula | C10H17ClN6 |
| Molecular Weight | 256.74 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 1-(5-chloro-2-hydrazinylpyrimidin-4-yl)-N,N-dimethylpyrrolidin-3-amine |
| SMILES | CN(C)C1CCN(c2nc(NN)ncc2Cl)C1 |
| InChI | InChI=1S/C10H17ClN6/c1-16(2)7-3-4-17(6-7)9-8(11)5-13-10(14-9)15-12/h5,7H,3-4,6,12H2,1-2H3,(H,13,14,15) |
| InChIKey | IMIUXUKEAWZRGH-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.74 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|