C10H17ClN6O — CID 80906441
2-[4-(5-chloro-2-hydrazinylpyrimidin-4-yl)piperazin-1-yl]ethanol (PubChem CID 80906441) has the molecular formula C10H17ClN6O and a molecular weight of 272.74 g/mol. Its IUPAC name is 2-[4-(5-chloro-2-hydrazinylpyrimidin-4-yl)piperazin-1-yl]ethanol.
| Compound Name | 2-[4-(5-chloro-2-hydrazinylpyrimidin-4-yl)piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 80906441 |
| Molecular Formula | C10H17ClN6O |
| Molecular Weight | 272.74 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 2-[4-(5-chloro-2-hydrazinylpyrimidin-4-yl)piperazin-1-yl]ethanol |
| SMILES | NNc1ncc(Cl)c(N2CCN(CCO)CC2)n1 |
| InChI | InChI=1S/C10H17ClN6O/c11-8-7-13-10(15-12)14-9(8)17-3-1-16(2-4-17)5-6-18/h7,18H,1-6,12H2,(H,13,14,15) |
| InChIKey | HBQZVFNVZKBVSG-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.74 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|