C11H19FN6O — CID 107226856
2-[4-(5-fluoro-2-hydrazinylpyrimidin-4-yl)-1,4-diazepan-1-yl]ethanol (PubChem CID 107226856) has the molecular formula C11H19FN6O and a molecular weight of 270.31 g/mol. Its IUPAC name is 2-[4-(5-fluoro-2-hydrazinylpyrimidin-4-yl)-1,4-diazepan-1-yl]ethanol.
| Compound Name | 2-[4-(5-fluoro-2-hydrazinylpyrimidin-4-yl)-1,4-diazepan-1-yl]ethanol |
|---|---|
| PubChem CID | 107226856 |
| Molecular Formula | C11H19FN6O |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | 2-[4-(5-fluoro-2-hydrazinylpyrimidin-4-yl)-1,4-diazepan-1-yl]ethanol |
| SMILES | NNc1ncc(F)c(N2CCCN(CCO)CC2)n1 |
| InChI | InChI=1S/C11H19FN6O/c12-9-8-14-11(16-13)15-10(9)18-3-1-2-17(4-5-18)6-7-19/h8,19H,1-7,13H2,(H,14,15,16) |
| InChIKey | QEQCVAGYQQWMOW-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|