C14H22FN5 — CID 80918943
[4-(3-azaspiro[5.5]undecan-3-yl)-5-fluoropyrimidin-2-yl]hydrazine (PubChem CID 80918943) has the molecular formula C14H22FN5 and a molecular weight of 279.36 g/mol. Its IUPAC name is [4-(3-azaspiro[5.5]undecan-3-yl)-5-fluoropyrimidin-2-yl]hydrazine.
| Compound Name | [4-(3-azaspiro[5.5]undecan-3-yl)-5-fluoropyrimidin-2-yl]hydrazine |
|---|---|
| PubChem CID | 80918943 |
| Molecular Formula | C14H22FN5 |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.19 |
| IUPAC Name | [4-(3-azaspiro[5.5]undecan-3-yl)-5-fluoropyrimidin-2-yl]hydrazine |
| SMILES | NNc1ncc(F)c(N2CCC3(CCCCC3)CC2)n1 |
| InChI | InChI=1S/C14H22FN5/c15-11-10-17-13(19-16)18-12(11)20-8-6-14(7-9-20)4-2-1-3-5-14/h10H,1-9,16H2,(H,17,18,19) |
| InChIKey | IEKFPYINVRNSSK-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|