C12H19FN6 — CID 80930087
[4-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-5-fluoropyrimidin-2-yl]hydrazine (PubChem CID 80930087) has the molecular formula C12H19FN6 and a molecular weight of 266.32 g/mol. Its IUPAC name is [4-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-5-fluoropyrimidin-2-yl]hydrazine.
| Compound Name | [4-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-5-fluoropyrimidin-2-yl]hydrazine |
|---|---|
| PubChem CID | 80930087 |
| Molecular Formula | C12H19FN6 |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | [4-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-5-fluoropyrimidin-2-yl]hydrazine |
| SMILES | NNc1ncc(F)c(N2CCN3CCCCC3C2)n1 |
| InChI | InChI=1S/C12H19FN6/c13-10-7-15-12(17-14)16-11(10)19-6-5-18-4-2-1-3-9(18)8-19/h7,9H,1-6,8,14H2,(H,15,16,17) |
| InChIKey | KLXIBCFVDCAZTG-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|