C15H24FN5 — CID 80837896
N-ethyl-5-fluoro-4-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)pyrimidin-2-amine (PubChem CID 80837896) has the molecular formula C15H24FN5 and a molecular weight of 293.39 g/mol. Its IUPAC name is N-ethyl-5-fluoro-4-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)pyrimidin-2-amine.
| Compound Name | N-ethyl-5-fluoro-4-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 80837896 |
| Molecular Formula | C15H24FN5 |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | N-ethyl-5-fluoro-4-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)pyrimidin-2-amine |
| SMILES | CCNc1ncc(F)c(N2CC3CCCCN3CC2C)n1 |
| InChI | InChI=1S/C15H24FN5/c1-3-17-15-18-8-13(16)14(19-15)21-10-12-6-4-5-7-20(12)9-11(21)2/h8,11-12H,3-7,9-10H2,1-2H3,(H,17,18,19) |
| InChIKey | GZKPOWYAKZGUSD-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |