C12H17FN4 — CID 80804390
4-(2-azabicyclo[2.2.1]heptan-2-yl)-N-ethyl-5-fluoropyrimidin-2-amine (PubChem CID 80804390) has the molecular formula C12H17FN4 and a molecular weight of 236.29 g/mol. Its IUPAC name is 4-(2-azabicyclo[2.2.1]heptan-2-yl)-N-ethyl-5-fluoropyrimidin-2-amine.
| Compound Name | 4-(2-azabicyclo[2.2.1]heptan-2-yl)-N-ethyl-5-fluoropyrimidin-2-amine |
|---|---|
| PubChem CID | 80804390 |
| Molecular Formula | C12H17FN4 |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | 4-(2-azabicyclo[2.2.1]heptan-2-yl)-N-ethyl-5-fluoropyrimidin-2-amine |
| SMILES | CCNc1ncc(F)c(N2CC3CCC2C3)n1 |
| InChI | InChI=1S/C12H17FN4/c1-2-14-12-15-6-10(13)11(16-12)17-7-8-3-4-9(17)5-8/h6,8-9H,2-5,7H2,1H3,(H,14,15,16) |
| InChIKey | OQDWEKDKLNLUAM-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |