C13H22FN5O — CID 80855954
5-[(dimethylamino)methyl]-1-[2-(ethylamino)-5-fluoropyrimidin-4-yl]pyrrolidin-3-ol (PubChem CID 80855954) has the molecular formula C13H22FN5O and a molecular weight of 283.35 g/mol. Its IUPAC name is 5-[(dimethylamino)methyl]-1-[2-(ethylamino)-5-fluoropyrimidin-4-yl]pyrrolidin-3-ol.
| Compound Name | 5-[(dimethylamino)methyl]-1-[2-(ethylamino)-5-fluoropyrimidin-4-yl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 80855954 |
| Molecular Formula | C13H22FN5O |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | 5-[(dimethylamino)methyl]-1-[2-(ethylamino)-5-fluoropyrimidin-4-yl]pyrrolidin-3-ol |
| SMILES | CCNc1ncc(F)c(N2CC(O)CC2CN(C)C)n1 |
| InChI | InChI=1S/C13H22FN5O/c1-4-15-13-16-6-11(14)12(17-13)19-8-10(20)5-9(19)7-18(2)3/h6,9-10,20H,4-5,7-8H2,1-3H3,(H,15,16,17) |
| InChIKey | WOBNNMDGMURZQF-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |