C12H20ClN5O — CID 80856110
1-[5-chloro-2-(methylamino)pyrimidin-4-yl]-5-[(dimethylamino)methyl]pyrrolidin-3-ol (PubChem CID 80856110) has the molecular formula C12H20ClN5O and a molecular weight of 285.78 g/mol. Its IUPAC name is 1-[5-chloro-2-(methylamino)pyrimidin-4-yl]-5-[(dimethylamino)methyl]pyrrolidin-3-ol.
| Compound Name | 1-[5-chloro-2-(methylamino)pyrimidin-4-yl]-5-[(dimethylamino)methyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 80856110 |
| Molecular Formula | C12H20ClN5O |
| Molecular Weight | 285.78 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | 1-[5-chloro-2-(methylamino)pyrimidin-4-yl]-5-[(dimethylamino)methyl]pyrrolidin-3-ol |
| SMILES | CNc1ncc(Cl)c(N2CC(O)CC2CN(C)C)n1 |
| InChI | InChI=1S/C12H20ClN5O/c1-14-12-15-5-10(13)11(16-12)18-7-9(19)4-8(18)6-17(2)3/h5,8-9,19H,4,6-7H2,1-3H3,(H,14,15,16) |
| InChIKey | YTHNTSJSOGRXRO-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.78 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |