C12H20N6O3 — CID 80831961
5-[(dimethylamino)methyl]-1-[6-(methylamino)-5-nitropyrimidin-4-yl]pyrrolidin-3-ol (PubChem CID 80831961) has the molecular formula C12H20N6O3 and a molecular weight of 296.33 g/mol. Its IUPAC name is 5-[(dimethylamino)methyl]-1-[6-(methylamino)-5-nitropyrimidin-4-yl]pyrrolidin-3-ol.
| Compound Name | 5-[(dimethylamino)methyl]-1-[6-(methylamino)-5-nitropyrimidin-4-yl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 80831961 |
| Molecular Formula | C12H20N6O3 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 5-[(dimethylamino)methyl]-1-[6-(methylamino)-5-nitropyrimidin-4-yl]pyrrolidin-3-ol |
| SMILES | CNc1ncnc(N2CC(O)CC2CN(C)C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H20N6O3/c1-13-11-10(18(20)21)12(15-7-14-11)17-6-9(19)4-8(17)5-16(2)3/h7-9,19H,4-6H2,1-3H3,(H,13,14,15) |
| InChIKey | SYAJJXXWXJGBLQ-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 107.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|