C12H20FN5O — CID 80856272
5-[(dimethylamino)methyl]-1-[5-fluoro-2-(methylamino)pyrimidin-4-yl]pyrrolidin-3-ol (PubChem CID 80856272) has the molecular formula C12H20FN5O and a molecular weight of 269.32 g/mol. Its IUPAC name is 5-[(dimethylamino)methyl]-1-[5-fluoro-2-(methylamino)pyrimidin-4-yl]pyrrolidin-3-ol.
| Compound Name | 5-[(dimethylamino)methyl]-1-[5-fluoro-2-(methylamino)pyrimidin-4-yl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 80856272 |
| Molecular Formula | C12H20FN5O |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | 5-[(dimethylamino)methyl]-1-[5-fluoro-2-(methylamino)pyrimidin-4-yl]pyrrolidin-3-ol |
| SMILES | CNc1ncc(F)c(N2CC(O)CC2CN(C)C)n1 |
| InChI | InChI=1S/C12H20FN5O/c1-14-12-15-5-10(13)11(16-12)18-7-9(19)4-8(18)6-17(2)3/h5,8-9,19H,4,6-7H2,1-3H3,(H,14,15,16) |
| InChIKey | NTWZWCJQMBCIMW-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |