C12H17FN4O — CID 80846696
8-[5-fluoro-2-(methylamino)pyrimidin-4-yl]-8-azabicyclo[3.2.1]octan-3-ol (PubChem CID 80846696) has the molecular formula C12H17FN4O and a molecular weight of 252.29 g/mol. Its IUPAC name is 8-[5-fluoro-2-(methylamino)pyrimidin-4-yl]-8-azabicyclo[3.2.1]octan-3-ol.
| Compound Name | 8-[5-fluoro-2-(methylamino)pyrimidin-4-yl]-8-azabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 80846696 |
| Molecular Formula | C12H17FN4O |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 8-[5-fluoro-2-(methylamino)pyrimidin-4-yl]-8-azabicyclo[3.2.1]octan-3-ol |
| SMILES | CNc1ncc(F)c(N2C3CCC2CC(O)C3)n1 |
| InChI | InChI=1S/C12H17FN4O/c1-14-12-15-6-10(13)11(16-12)17-7-2-3-8(17)5-9(18)4-7/h6-9,18H,2-5H2,1H3,(H,14,15,16) |
| InChIKey | UCZLJOLPVVMKLY-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |