C12H19FN4O — CID 80798443
4-(4-ethoxypiperidin-1-yl)-5-fluoro-N-methylpyrimidin-2-amine (PubChem CID 80798443) has the molecular formula C12H19FN4O and a molecular weight of 254.31 g/mol. Its IUPAC name is 4-(4-ethoxypiperidin-1-yl)-5-fluoro-N-methylpyrimidin-2-amine.
| Compound Name | 4-(4-ethoxypiperidin-1-yl)-5-fluoro-N-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 80798443 |
| Molecular Formula | C12H19FN4O |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 4-(4-ethoxypiperidin-1-yl)-5-fluoro-N-methylpyrimidin-2-amine |
| SMILES | CCOC1CCN(c2nc(NC)ncc2F)CC1 |
| InChI | InChI=1S/C12H19FN4O/c1-3-18-9-4-6-17(7-5-9)11-10(13)8-15-12(14-2)16-11/h8-9H,3-7H2,1-2H3,(H,14,15,16) |
| InChIKey | DXICCZMHZQTCGI-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |