C13H20FN5O — CID 80754662
1-[5-fluoro-2-(propylamino)pyrimidin-4-yl]piperidine-4-carboxamide (PubChem CID 80754662) has the molecular formula C13H20FN5O and a molecular weight of 281.33 g/mol. Its IUPAC name is 1-[5-fluoro-2-(propylamino)pyrimidin-4-yl]piperidine-4-carboxamide.
| Compound Name | 1-[5-fluoro-2-(propylamino)pyrimidin-4-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 80754662 |
| Molecular Formula | C13H20FN5O |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 1-[5-fluoro-2-(propylamino)pyrimidin-4-yl]piperidine-4-carboxamide |
| SMILES | CCCNc1ncc(F)c(N2CCC(C(N)=O)CC2)n1 |
| InChI | InChI=1S/C13H20FN5O/c1-2-5-16-13-17-8-10(14)12(18-13)19-6-3-9(4-7-19)11(15)20/h8-9H,2-7H2,1H3,(H2,15,20)(H,16,17,18) |
| InChIKey | DVIMKUSREWJSRL-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |