C14H24FN5 — CID 80856544
4-[3-(dimethylamino)piperidin-1-yl]-5-fluoro-N-propylpyrimidin-2-amine (PubChem CID 80856544) has the molecular formula C14H24FN5 and a molecular weight of 281.38 g/mol. Its IUPAC name is 4-[3-(dimethylamino)piperidin-1-yl]-5-fluoro-N-propylpyrimidin-2-amine.
| Compound Name | 4-[3-(dimethylamino)piperidin-1-yl]-5-fluoro-N-propylpyrimidin-2-amine |
|---|---|
| PubChem CID | 80856544 |
| Molecular Formula | C14H24FN5 |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | 4-[3-(dimethylamino)piperidin-1-yl]-5-fluoro-N-propylpyrimidin-2-amine |
| SMILES | CCCNc1ncc(F)c(N2CCCC(N(C)C)C2)n1 |
| InChI | InChI=1S/C14H24FN5/c1-4-7-16-14-17-9-12(15)13(18-14)20-8-5-6-11(10-20)19(2)3/h9,11H,4-8,10H2,1-3H3,(H,16,17,18) |
| InChIKey | QNPNJOHQCDTHFL-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |