C14H22FN5 — CID 80799247
4-[4-(cyclopropylmethyl)piperazin-1-yl]-N-ethyl-5-fluoropyrimidin-2-amine (PubChem CID 80799247) has the molecular formula C14H22FN5 and a molecular weight of 279.36 g/mol. Its IUPAC name is 4-[4-(cyclopropylmethyl)piperazin-1-yl]-N-ethyl-5-fluoropyrimidin-2-amine.
| Compound Name | 4-[4-(cyclopropylmethyl)piperazin-1-yl]-N-ethyl-5-fluoropyrimidin-2-amine |
|---|---|
| PubChem CID | 80799247 |
| Molecular Formula | C14H22FN5 |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.19 |
| IUPAC Name | 4-[4-(cyclopropylmethyl)piperazin-1-yl]-N-ethyl-5-fluoropyrimidin-2-amine |
| SMILES | CCNc1ncc(F)c(N2CCN(CC3CC3)CC2)n1 |
| InChI | InChI=1S/C14H22FN5/c1-2-16-14-17-9-12(15)13(18-14)20-7-5-19(6-8-20)10-11-3-4-11/h9,11H,2-8,10H2,1H3,(H,16,17,18) |
| InChIKey | SZPSJEHLQUFOPW-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |