C14H24ClN5O — CID 80832257
1-[5-chloro-2-(propylamino)pyrimidin-4-yl]-5-[(dimethylamino)methyl]pyrrolidin-3-ol (PubChem CID 80832257) has the molecular formula C14H24ClN5O and a molecular weight of 313.83 g/mol. Its IUPAC name is 1-[5-chloro-2-(propylamino)pyrimidin-4-yl]-5-[(dimethylamino)methyl]pyrrolidin-3-ol.
| Compound Name | 1-[5-chloro-2-(propylamino)pyrimidin-4-yl]-5-[(dimethylamino)methyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 80832257 |
| Molecular Formula | C14H24ClN5O |
| Molecular Weight | 313.83 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | 1-[5-chloro-2-(propylamino)pyrimidin-4-yl]-5-[(dimethylamino)methyl]pyrrolidin-3-ol |
| SMILES | CCCNc1ncc(Cl)c(N2CC(O)CC2CN(C)C)n1 |
| InChI | InChI=1S/C14H24ClN5O/c1-4-5-16-14-17-7-12(15)13(18-14)20-9-11(21)6-10(20)8-19(2)3/h7,10-11,21H,4-6,8-9H2,1-3H3,(H,16,17,18) |
| InChIKey | BEFUXUCHQFSYKB-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.83 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |