C15H27N5O — CID 80832344
5-[(dimethylamino)methyl]-1-[6-methyl-2-(propylamino)pyrimidin-4-yl]pyrrolidin-3-ol (PubChem CID 80832344) has the molecular formula C15H27N5O and a molecular weight of 293.42 g/mol. Its IUPAC name is 5-[(dimethylamino)methyl]-1-[6-methyl-2-(propylamino)pyrimidin-4-yl]pyrrolidin-3-ol.
| Compound Name | 5-[(dimethylamino)methyl]-1-[6-methyl-2-(propylamino)pyrimidin-4-yl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 80832344 |
| Molecular Formula | C15H27N5O |
| Molecular Weight | 293.42 g/mol |
| Exact Mass | 293.22 |
| IUPAC Name | 5-[(dimethylamino)methyl]-1-[6-methyl-2-(propylamino)pyrimidin-4-yl]pyrrolidin-3-ol |
| SMILES | CCCNc1nc(C)cc(N2CC(O)CC2CN(C)C)n1 |
| InChI | InChI=1S/C15H27N5O/c1-5-6-16-15-17-11(2)7-14(18-15)20-10-13(21)8-12(20)9-19(3)4/h7,12-13,21H,5-6,8-10H2,1-4H3,(H,16,17,18) |
| InChIKey | GEFBYUPPSMKMNU-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.42 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |